| MolName | N,N'-bis[(Z)-benzylideneamino]-2-[(4-nitrophenyl)methylidene]propanediamide |
| MolecularFormula | C24H19N5O4 |
| Smiles | [O-][N+](c1ccc(C=C(C(N/N=C\c2ccccc2)=O)C(N/N=C\c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C24H19N5O4/c30-23(27-25-16-19-7-3-1-4-8-19)22(15-18-11-13-21(14-12-18)29(32)33)24(31)28-26-17-20-9-5-2-6-10-20/h1-17H,(H,27,30)(H,28,31) |
| InChIK | PICAMCYBPLIUMY-UHFFFAOYSA-N |
| TotalMolweight | 441.446 |
| Molweight | 441.446 |
| MonoisotopicMass | 441.143705 |
| CLogP | 3.9962 |
| CLogS | -6.242 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 349.1 |
| Relative PSA | 0.29344 |
| PolarSurfaceArea | 128.74 |
| Druglikeness | 0.43938 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 15 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-benzylideneamino]-2-[(4-nitrophenyl)methylidene]propanediamide | 2 - N,N'-bis[(Z)-benzylideneamino]-2-[(4-nitrophenyl)methylidene]propanediamide