| MolName | 5-amino-3-(4-chlorophenyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-oxothieno[3,4-d]pyridazine-1-carboxamide |
| MolecularFormula | C20H13N6O4ClS |
| Smiles | Nc(scc1C(C(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)=NN2c(cc3)ccc3Cl)c1C2=O |
| InChI | InChI=1S/C20H13ClN6O4S/c21-12-3-7-13(8-4-12)26-20(29)16-15(10-32-18(16)22)17(25-26)19(28)24-23-9-11-1-5-14(6-2-11)27(30)31/h1-10H,22H2,(H,24,28) |
| InChIK | PIHHQNJJEIKTGP-UHFFFAOYSA-N |
| TotalMolweight | 468.88 |
| Molweight | 468.88 |
| MonoisotopicMass | 468.040751 |
| CLogP | 3.1954 |
| CLogS | -6.594 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 327.82 |
| Relative PSA | 0.39705 |
| PolarSurfaceArea | 174.21 |
| Druglikeness | 2.2301 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-amino-3-(4-chlorophenyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-oxothieno[3,4-d]pyridazine-1-carboxamide | 2 - 5-amino-3-(4-chlorophenyl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-4-oxothieno[3,4-d]pyridazine-1-carboxamide