| MolName | 17-[(Z)-(3-chlorophenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| MolecularFormula | C27H19N6OCl |
| Smiles | O=C1N(CCc2ccccc2)C=Nc2c1c1nc3ccccc3nc1n2/N=C\c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H19ClN6O/c28-20-10-6-9-19(15-20)16-30-34-25-23(24-26(34)32-22-12-5-4-11-21(22)31-24)27(35)33(17-29-25)14-13-18-7-2-1-3-8-18/h1-12,15-17H,13-14H2 |
| InChIK | PIHZRYWIBCSCKO-UHFFFAOYSA-N |
| TotalMolweight | 478.942 |
| Molweight | 478.942 |
| MonoisotopicMass | 478.130886 |
| CLogP | 5.3007 |
| CLogS | -9.353 |
| H Acceptors | 7 |
| TotalSurfaceArea | 355.71 |
| Relative PSA | 0.19235 |
| PolarSurfaceArea | 75.74 |
| Druglikeness | 6.9721 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 17-[(Z)-(3-chlorophenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one | 2 - 17-[(Z)-(3-chlorophenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one