| MolName | [(Z)-[3-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]methylideneamino]thiourea |
| MolecularFormula | C16H16N3OClS2 |
| Smiles | NC(N/N=C\c1cccc(OCCSc(cc2)ccc2Cl)c1)=S |
| InChI | InChI=1S/C16H16ClN3OS2/c17-13-4-6-15(7-5-13)23-9-8-21-14-3-1-2-12(10-14)11-19-20-16(18)22/h1-7,10-11H,8-9H2,(H3,18,20,22) |
| InChIK | PINGSYOKLBXDNZ-UHFFFAOYSA-N |
| TotalMolweight | 365.908 |
| Molweight | 365.908 |
| MonoisotopicMass | 365.042329 |
| CLogP | 4.1309 |
| CLogS | -5.664 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 280.9 |
| Relative PSA | 0.33368 |
| PolarSurfaceArea | 117.03 |
| Druglikeness | 2.317 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[3-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]methylideneamino]thiourea | 2 - [(Z)-[3-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]methylideneamino]thiourea