| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| MolecularFormula | C13H16N3O2Cl |
| Smiles | O=C(CN1CCOCC1)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C13H16ClN3O2/c14-12-3-1-11(2-4-12)9-15-16-13(18)10-17-5-7-19-8-6-17/h1-4,9H,5-8,10H2,(H,16,18) |
| InChIK | PIXKRWWWJNEPCM-UHFFFAOYSA-N |
| TotalMolweight | 281.742 |
| Molweight | 281.742 |
| MonoisotopicMass | 281.093104 |
| CLogP | 1.6263 |
| CLogS | -2.477 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 218.25 |
| Relative PSA | 0.22708 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 5.4564 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73684 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-morpholin-4-ylacetamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-morpholin-4-ylacetamide