| MolName | 2-(4-bromophenyl)-N-[(Z)-[(2Z)-2-[[2-(4-bromophenyl)acetyl]hydrazinylidene]ethylidene]amino]acetamide |
| MolecularFormula | C18H16N4O2Br2 |
| Smiles | O=C(Cc(cc1)ccc1Br)N/N=C\C=N/NC(Cc(cc1)ccc1Br)=O |
| InChI | InChI=1S/C18H16Br2N4O2/c19-15-5-1-13(2-6-15)11-17(25)23-21-9-10-22-24-18(26)12-14-3-7-16(20)8-4-14/h1-10H,11-12H2,(H,23,25)(H,24,26) |
| InChIK | PIZHEGFZCUFROS-UHFFFAOYSA-N |
| TotalMolweight | 480.159 |
| Molweight | 480.159 |
| MonoisotopicMass | 477.963998 |
| CLogP | 3.3632 |
| CLogS | -5.56 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 305.74 |
| Relative PSA | 0.23556 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 2.5805 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76923 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 15 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-bromophenyl)-N-[(Z)-[(2Z)-2-[[2-(4-bromophenyl)acetyl]hydrazinylidene]ethylidene]amino]acetamide | 2 - 2-(4-bromophenyl)-N-[(Z)-[(2Z)-2-[[2-(4-bromophenyl)acetyl]hydrazinylidene]ethylidene]amino]acetamide