| MolName | 4-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C23H17N7S |
| Smiles | S=C(NN=C1c2ccncc2)N1/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H17N7S/c31-23-27-26-22(18-11-13-24-14-12-18)30(23)25-15-19-16-29(20-9-5-2-6-10-20)28-21(19)17-7-3-1-4-8-17/h1-16H,(H,27,31) |
| InChIK | PJEYCFBTOJBEBV-UHFFFAOYSA-N |
| TotalMolweight | 423.503 |
| Molweight | 423.503 |
| MonoisotopicMass | 423.126613 |
| CLogP | 3.2131 |
| CLogS | -5.169 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 327.96 |
| Relative PSA | 0.28918 |
| PolarSurfaceArea | 102.79 |
| Druglikeness | 4.1245 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione