| MolName | 1-N,1-N'-bis[(Z)-(3-nitrophenyl)methylideneamino]cyclobutane-1,1-dicarboxamide |
| MolecularFormula | C20H18N6O6 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(C2(CCC2)C(N/N=C\c2cccc([N+]([O-])=O)c2)=O)=O)c1)=O |
| InChI | InChI=1S/C20H18N6O6/c27-18(23-21-12-14-4-1-6-16(10-14)25(29)30)20(8-3-9-20)19(28)24-22-13-15-5-2-7-17(11-15)26(31)32/h1-2,4-7,10-13H,3,8-9H2,(H,23,27)(H,24,28) |
| InChIK | PJFXAYAKHHBFDB-UHFFFAOYSA-N |
| TotalMolweight | 438.399 |
| Molweight | 438.399 |
| MonoisotopicMass | 438.128784 |
| CLogP | 1.6868 |
| CLogS | -6.001 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 326.49 |
| Relative PSA | 0.40693 |
| PolarSurfaceArea | 174.56 |
| Druglikeness | -0.78225 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 15 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-N,1-N'-bis[(Z)-(3-nitrophenyl)methylideneamino]cyclobutane-1,1-dicarboxamide | 2 - 1-N,1-N'-bis[(Z)-(3-nitrophenyl)methylideneamino]cyclobutane-1,1-dicarboxamide