| MolName | 1-[(Z)-(2,4-dimorpholin-4-yl-5-nitrophenyl)methylideneamino]-3-phenylurea |
| MolecularFormula | C22H26N6O5 |
| Smiles | [O-][N+](c(cc(/C=N\NC(Nc1ccccc1)=O)c(N1CCOCC1)c1)c1N1CCOCC1)=O |
| InChI | InChI=1S/C22H26N6O5/c29-22(24-18-4-2-1-3-5-18)25-23-16-17-14-21(28(30)31)20(27-8-12-33-13-9-27)15-19(17)26-6-10-32-11-7-26/h1-5,14-16H,6-13H2,(H2,24,25,29) |
| InChIK | PJJAJUWUESTMIN-UHFFFAOYSA-N |
| TotalMolweight | 454.485 |
| Molweight | 454.485 |
| MonoisotopicMass | 454.196469 |
| CLogP | 1.6119 |
| CLogS | -4.903 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 345.8 |
| Relative PSA | 0.30361 |
| PolarSurfaceArea | 124.25 |
| Druglikeness | -0.50186 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Amines | 2 |
| Aromatic Amines | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-(2,4-dimorpholin-4-yl-5-nitrophenyl)methylideneamino]-3-phenylurea | 2 - 1-[(Z)-(2,4-dimorpholin-4-yl-5-nitrophenyl)methylideneamino]-3-phenylurea