| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(4-benzylpiperazin-1-yl)methyl]benzamide |
| MolecularFormula | C27H28N4O3 |
| Smiles | O=C(c1ccc(CN2CCN(Cc3ccccc3)CC2)cc1)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C27H28N4O3/c32-27(29-28-17-23-8-11-25-26(16-23)34-20-33-25)24-9-6-22(7-10-24)19-31-14-12-30(13-15-31)18-21-4-2-1-3-5-21/h1-11,16-17H,12-15,18-20H2,(H,29,32) |
| InChIK | PJQNRCUCGNSBID-UHFFFAOYSA-N |
| TotalMolweight | 456.544 |
| Molweight | 456.544 |
| MonoisotopicMass | 456.216141 |
| CLogP | 4.4324 |
| CLogS | -4.838 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 356.67 |
| Relative PSA | 0.17694 |
| PolarSurfaceArea | 66.4 |
| Druglikeness | 9.0156 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67647 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(4-benzylpiperazin-1-yl)methyl]benzamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(4-benzylpiperazin-1-yl)methyl]benzamide