| MolName | 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2-nitrophenolate |
| MolecularFormula | C12H9N6O6S |
| Smiles | [O-]c(ccc(/C=N\NC(CSC(C(N1)=O)=NNC1=O)=O)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C12H10N6O6S/c19-8-2-1-6(3-7(8)18(23)24)4-13-15-9(20)5-25-11-10(21)14-12(22)17-16-11/h1-4,19H,5H2,(H,15,20)(H2,14,17,21,22)/p-1 |
| InChIK | PJRLFSPWYDHYGI-UHFFFAOYSA-M |
| TotalMolweight | 365.305 |
| Molweight | 365.305 |
| MonoisotopicMass | 365.030429 |
| CLogP | -2.7468 |
| CLogS | -3.09 |
| H Acceptors | 12 |
| H Donors | 3 |
| TotalSurfaceArea | 257.57 |
| Relative PSA | 0.61618 |
| PolarSurfaceArea | 206.2 |
| Druglikeness | 1.8552 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2-nitrophenolate | 2 - 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetyl]hydrazinylidene]methyl]-2-nitrophenolate