| MolName | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide |
| MolecularFormula | C27H26N6O2S |
| Smiles | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H26N6O2S/c34-25(29-28-19-21-11-13-23(14-12-21)32-15-17-35-18-16-32)20-36-27-31-30-26(22-7-3-1-4-8-22)33(27)24-9-5-2-6-10-24/h1-14,19H,15-18,20H2,(H,29,34) |
| InChIK | PJZOKIKLGRDJIP-UHFFFAOYSA-N |
| TotalMolweight | 498.609 |
| Molweight | 498.609 |
| MonoisotopicMass | 498.183794 |
| CLogP | 4.2008 |
| CLogS | -8.519 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 386.32 |
| Relative PSA | 0.24814 |
| PolarSurfaceArea | 109.94 |
| Druglikeness | 5.5142 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 7 |
| Symmetricatoms | 8 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide | 2 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]acetamide