| MolName | 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C13H10N5O5S |
| Smiles | [O-]C(c1ccc(/C=N\NC(CSC(C(N2)=O)=NNC2=O)=O)cc1)=O |
| InChI | InChI=1S/C13H11N5O5S/c19-9(6-24-11-10(20)15-13(23)18-17-11)16-14-5-7-1-3-8(4-2-7)12(21)22/h1-5H,6H2,(H,16,19)(H,21,22)(H2,15,18,20,23)/p-1 |
| InChIK | PKIZLLUSFKSDHD-UHFFFAOYSA-M |
| TotalMolweight | 348.318 |
| Molweight | 348.318 |
| MonoisotopicMass | 348.040265 |
| CLogP | -2.4924 |
| CLogS | -2.939 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 251.65 |
| Relative PSA | 0.56161 |
| PolarSurfaceArea | 177.45 |
| Druglikeness | 6.9677 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetyl]hydrazinylidene]methyl]benzoate