| MolName | 2-N-[(Z)-[4-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C36H40N14 |
| Smiles | C(CC1)CCN1c1nc(Nc2ccccc2)nc(N/N=C\c2ccc(/C=N\Nc3nc(Nc4ccccc4)nc(N4CCCCC4)n3)cc2)n1 |
| InChI | InChI=1S/C36H40N14/c1-5-13-29(14-6-1)39-31-41-33(45-35(43-31)49-21-9-3-10-22-49)47-37-25-27-17-19-28(20-18-27)26-38-48-34-42-32(40-30-15-7-2-8-16-30)44-36(46-34)50-23-11-4-12-24-50/h1-2,5-8,13-20,25-26H,3-4,9-12,21-24H2,(H2,39,41,43,45,47)(H2,40,42,44,46, |
| InChIK | PKJFZRPKXIAHKG-UHFFFAOYSA-N |
| TotalMolweight | 668.812 |
| Molweight | 668.812 |
| MonoisotopicMass | 668.356036 |
| CLogP | 11.592 |
| CLogS | -10.194 |
| H Acceptors | 14 |
| H Donors | 4 |
| TotalSurfaceArea | 531.42 |
| Relative PSA | 0.26679 |
| PolarSurfaceArea | 156.66 |
| Druglikeness | 2.9678 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 50 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 12 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 10 |
| Symmetricatoms | 30 |
| Aromatic Nitrogens | 6 |
| BasicNitrogens | 6 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[4-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[4-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine