| MolName | 2-[(2-chlorophenyl)methyl]-4-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,4-triazole-3-thione |
| MolecularFormula | C14H10N5O3ClS |
| Smiles | [O-][N+](c1ccc(/C=N\N(C=NN2Cc(cccc3)c3Cl)C2=S)o1)=O |
| InChI | InChI=1S/C14H10ClN5O3S/c15-12-4-2-1-3-10(12)8-18-14(24)19(9-17-18)16-7-11-5-6-13(23-11)20(21)22/h1-7,9H,8H2 |
| InChIK | PKKASTRCHUJKOK-UHFFFAOYSA-N |
| TotalMolweight | 363.784 |
| Molweight | 363.784 |
| MonoisotopicMass | 363.019287 |
| CLogP | 2.3088 |
| CLogS | -5.671 |
| H Acceptors | 8 |
| TotalSurfaceArea | 264.89 |
| Relative PSA | 0.38752 |
| PolarSurfaceArea | 122.25 |
| Druglikeness | 3.209 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2-chlorophenyl)methyl]-4-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,4-triazole-3-thione | 2 - 2-[(2-chlorophenyl)methyl]-4-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,2,4-triazole-3-thione