| MolName | N-[(E)-(4-phenylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C23H20N4S |
| Smiles | C(CC1)Cc2c1sc1ncnc(N/N=C/c(cc3)ccc3-c3ccccc3)c12 |
| InChI | InChI=1S/C23H20N4S/c1-2-6-17(7-3-1)18-12-10-16(11-13-18)14-26-27-22-21-19-8-4-5-9-20(19)28-23(21)25-15-24-22/h1-3,6-7,10-15H,4-5,8-9H2,(H,24,25,27) |
| InChIK | PKKMVFQKVGMGIE-UHFFFAOYSA-N |
| TotalMolweight | 384.506 |
| Molweight | 384.506 |
| MonoisotopicMass | 384.140866 |
| CLogP | 7.5627 |
| CLogS | -7.924 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 298.6 |
| Relative PSA | 0.21859 |
| PolarSurfaceArea | 78.41 |
| Druglikeness | -1.3412 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(4-phenylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine | 2 - N-[(E)-(4-phenylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine