| MolName | N-[5-[2-oxo-2-[(2Z)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide |
| MolecularFormula | C21H14N5O4F3S |
| Smiles | O=C(Cc1nnc(NC(c2ccco2)=O)s1)N/N=C\c1ccc(-c2cc(C(F)(F)F)ccc2)o1 |
| InChI | InChI=1S/C21H14F3N5O4S/c22-21(23,24)13-4-1-3-12(9-13)15-7-6-14(33-15)11-25-27-17(30)10-18-28-29-20(34-18)26-19(31)16-5-2-8-32-16/h1-9,11H,10H2,(H,27,30)(H,26,29,31) |
| InChIK | PKTXYLAPXGHLCV-UHFFFAOYSA-N |
| TotalMolweight | 489.433 |
| Molweight | 489.433 |
| MonoisotopicMass | 489.071859 |
| CLogP | 4.1661 |
| CLogS | -6.325 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 351.78 |
| Relative PSA | 0.37248 |
| PolarSurfaceArea | 150.86 |
| Druglikeness | 1.0846 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-oxo-2-[(2Z)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide | 2 - N-[5-[2-oxo-2-[(2Z)-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]-1,3,4-thiadiazol-2-yl]furan-2-carboxamide