| MolName | N-[2-[(2Z)-2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| MolecularFormula | C21H17N3O3Br2 |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\c(o1)cc(Br)c1Br |
| InChI | InChI=1S/C21H17Br2N3O3/c22-17-11-16(29-20(17)23)12-25-26-18(27)13-24-21(28)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,19H,13H2,(H,24,28)(H,26,27) |
| InChIK | PKWOGCSHGYCVDS-UHFFFAOYSA-N |
| TotalMolweight | 519.192 |
| Molweight | 519.192 |
| MonoisotopicMass | 516.963664 |
| CLogP | 4.5475 |
| CLogS | -5.715 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 329.17 |
| Relative PSA | 0.22669 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 1.0638 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide | 2 - N-[2-[(2Z)-2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide