| MolName | 3-(4-phenylmethoxyphenyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C26H22N4O2 |
| Smiles | O=C(c1cc(-c(cc2)ccc2OCc2ccccc2)n[nH]1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C26H22N4O2/c31-26(30-27-17-7-12-20-8-3-1-4-9-20)25-18-24(28-29-25)22-13-15-23(16-14-22)32-19-21-10-5-2-6-11-21/h1-18H,19H2,(H,28,29)(H,30,31) |
| InChIK | PLEPNAMLRSFPIC-UHFFFAOYSA-N |
| TotalMolweight | 422.487 |
| Molweight | 422.487 |
| MonoisotopicMass | 422.174276 |
| CLogP | 4.2658 |
| CLogS | -5.729 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 345.1 |
| Relative PSA | 0.20565 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 5.34 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-phenylmethoxyphenyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide | 2 - 3-(4-phenylmethoxyphenyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide