| MolName | 5-nitro-N-[(Z)-(1,2,5-triphenylpyrrol-3-yl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C28H21N5O2 |
| Smiles | [O-][N+](c(cc1)cnc1N/N=C\c(cc1-c2ccccc2)c(-c2ccccc2)n1-c1ccccc1)=O |
| InChI | InChI=1S/C28H21N5O2/c34-33(35)25-16-17-27(29-20-25)31-30-19-23-18-26(21-10-4-1-5-11-21)32(24-14-8-3-9-15-24)28(23)22-12-6-2-7-13-22/h1-20H,(H,29,31) |
| InChIK | PNGBIGFDWPAJHE-UHFFFAOYSA-N |
| TotalMolweight | 459.508 |
| Molweight | 459.508 |
| MonoisotopicMass | 459.169525 |
| CLogP | 6.9551 |
| CLogS | -9.208 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 360.15 |
| Relative PSA | 0.19778 |
| PolarSurfaceArea | 88.03 |
| Druglikeness | -1.4124 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.45714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-nitro-N-[(Z)-(1,2,5-triphenylpyrrol-3-yl)methylideneamino]pyridin-2-amine | 2 - 5-nitro-N-[(Z)-(1,2,5-triphenylpyrrol-3-yl)methylideneamino]pyridin-2-amine