| MolName | N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-[(2,5-dichlorophenyl)sulfamoyl]benzamide |
| MolecularFormula | C24H16N3O4Cl3S |
| Smiles | O=C(c1cccc(S(Nc(cc(cc2)Cl)c2Cl)(=O)=O)c1)N/N=C\c1ccc(-c(cccc2)c2Cl)o1 |
| InChI | InChI=1S/C24H16Cl3N3O4S/c25-16-8-10-21(27)22(13-16)30-35(32,33)18-5-3-4-15(12-18)24(31)29-28-14-17-9-11-23(34-17)19-6-1-2-7-20(19)26/h1-14,30H,(H,29,31) |
| InChIK | PNNXZLOYJDNCAP-UHFFFAOYSA-N |
| TotalMolweight | 548.833 |
| Molweight | 548.833 |
| MonoisotopicMass | 546.992708 |
| CLogP | 6.2576 |
| CLogS | -8.722 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 382.5 |
| Relative PSA | 0.23571 |
| PolarSurfaceArea | 109.15 |
| Druglikeness | 3.6912 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-[(2,5-dichlorophenyl)sulfamoyl]benzamide | 2 - N-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-[(2,5-dichlorophenyl)sulfamoyl]benzamide