| MolName | 2-[4-chloro-2-(1,2-oxazol-5-yl)phenoxy]-N-[(Z)-(4,6-dichloro-2H-chromen-3-yl)methylideneamino]acetamide |
| MolecularFormula | C21H14N3O4Cl3 |
| Smiles | O=C(COc(ccc(Cl)c1)c1-c1ccno1)N/N=C\C(COc(cc1)c2cc1Cl)=C2Cl |
| InChI | InChI=1S/C21H14Cl3N3O4/c22-13-1-3-17(15(7-13)19-5-6-26-31-19)30-11-20(28)27-25-9-12-10-29-18-4-2-14(23)8-16(18)21(12)24/h1-9H,10-11H2,(H,27,28) |
| InChIK | PNTIPBMHWGOTNX-UHFFFAOYSA-N |
| TotalMolweight | 478.718 |
| Molweight | 478.718 |
| MonoisotopicMass | 477.004988 |
| CLogP | 4.528 |
| CLogS | -5.277 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 338.4 |
| Relative PSA | 0.23963 |
| PolarSurfaceArea | 85.95 |
| Druglikeness | 4.9221 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | allyl/benzyl chloride; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-chloro-2-(1,2-oxazol-5-yl)phenoxy]-N-[(Z)-(4,6-dichloro-2H-chromen-3-yl)methylideneamino]acetamide | 2 - 2-[4-chloro-2-(1,2-oxazol-5-yl)phenoxy]-N-[(Z)-(4,6-dichloro-2H-chromen-3-yl)methylideneamino]acetamide