| MolName | N-[2-[[(Z)-(2-chlorophenyl)methylideneamino]carbamoyl]phenyl]furan-2-carboxamide |
| MolecularFormula | C19H14N3O3Cl |
| Smiles | O=C(c1ccco1)Nc(cccc1)c1C(N/N=C\c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C19H14ClN3O3/c20-15-8-3-1-6-13(15)12-21-23-18(24)14-7-2-4-9-16(14)22-19(25)17-10-5-11-26-17/h1-12H,(H,22,25)(H,23,24) |
| InChIK | POKRRPMAYGBZGR-UHFFFAOYSA-N |
| TotalMolweight | 367.791 |
| Molweight | 367.791 |
| MonoisotopicMass | 367.072369 |
| CLogP | 4.1438 |
| CLogS | -5.651 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 281.07 |
| Relative PSA | 0.26549 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 4.9094 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[[(Z)-(2-chlorophenyl)methylideneamino]carbamoyl]phenyl]furan-2-carboxamide | 2 - N-[2-[[(Z)-(2-chlorophenyl)methylideneamino]carbamoyl]phenyl]furan-2-carboxamide