| MolName | 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]benzoic acid |
| MolecularFormula | C15H11N3O2S |
| Smiles | OC(c1c(/C=N\Nc2nc(cccc3)c3s2)cccc1)=O |
| InChI | InChI=1S/C15H11N3O2S/c19-14(20)11-6-2-1-5-10(11)9-16-18-15-17-12-7-3-4-8-13(12)21-15/h1-9H,(H,17,18)(H,19,20) |
| InChIK | POLSORPKQCANGR-UHFFFAOYSA-N |
| TotalMolweight | 297.337 |
| Molweight | 297.337 |
| MonoisotopicMass | 297.057197 |
| CLogP | 4.958 |
| CLogS | -4.129 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 222.64 |
| Relative PSA | 0.3613 |
| PolarSurfaceArea | 102.82 |
| Druglikeness | 2.2734 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]benzoic acid | 2 - 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]benzoic acid