| MolName | (Z)-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C20H15N3O2 |
| Smiles | [O-][N+](c1c(/C=N\N=C(c2ccccc2)c2ccccc2)cccc1)=O |
| InChI | InChI=1S/C20H15N3O2/c24-23(25)19-14-8-7-13-18(19)15-21-22-20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15H |
| InChIK | PONBXEMWPCIEML-UHFFFAOYSA-N |
| TotalMolweight | 329.358 |
| Molweight | 329.358 |
| MonoisotopicMass | 329.116427 |
| CLogP | 5.0607 |
| CLogS | -6.368 |
| H Acceptors | 5 |
| TotalSurfaceArea | 264.18 |
| Relative PSA | 0.20229 |
| PolarSurfaceArea | 70.54 |
| Druglikeness | -3.5537 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.48 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,1-diphenylmethanimine