| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| MolecularFormula | C23H18N2O2ClP |
| Smiles | O=P1(C=C(c2ccccc2)OC(c2ccccc2)=C1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C23H18ClN2O2P/c24-21-14-8-7-13-20(21)15-25-26-29(27)16-22(18-9-3-1-4-10-18)28-23(17-29)19-11-5-2-6-12-19/h1-17H,(H,26,27) |
| InChIK | PQGXVOUBXHHSCO-UHFFFAOYSA-N |
| TotalMolweight | 420.835 |
| Molweight | 420.835 |
| MonoisotopicMass | 420.079442 |
| CLogP | 5.386 |
| CLogS | -4.297 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 314.11 |
| Relative PSA | 0.15915 |
| PolarSurfaceArea | 60.5 |
| Druglikeness | -12.05 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48276 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine