| MolName | N-naphthalen-1-yl-N'-[(Z)-(3-phenoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C25H19N3O3 |
| Smiles | O=C(C(N/N=C\c1cc(Oc2ccccc2)ccc1)=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C25H19N3O3/c29-24(27-23-15-7-10-19-9-4-5-14-22(19)23)25(30)28-26-17-18-8-6-13-21(16-18)31-20-11-2-1-3-12-20/h1-17H,(H,27,29)(H,28,30) |
| InChIK | PQVPUGZBBJTIJS-UHFFFAOYSA-N |
| TotalMolweight | 409.444 |
| Molweight | 409.444 |
| MonoisotopicMass | 409.142642 |
| CLogP | 4.7339 |
| CLogS | -7.428 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 320.56 |
| Relative PSA | 0.21996 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 3.6351 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-naphthalen-1-yl-N'-[(Z)-(3-phenoxyphenyl)methylideneamino]oxamide | 2 - N-naphthalen-1-yl-N'-[(Z)-(3-phenoxyphenyl)methylideneamino]oxamide