| MolName | 3-(2,5-dichlorophenyl)sulfonyl-1-[(Z)-furan-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxalin-2-amine |
| MolecularFormula | C21H13N5O3Cl2S |
| Smiles | Nc(n(c1nc2ccccc2nc11)/N=C\c2ccco2)c1S(c(cc(cc1)Cl)c1Cl)(=O)=O |
| InChI | InChI=1S/C21H13Cl2N5O3S/c22-12-7-8-14(23)17(10-12)32(29,30)19-18-21(27-16-6-2-1-5-15(16)26-18)28(20(19)24)25-11-13-4-3-9-31-13/h1-11H,24H2 |
| InChIK | PQWZEJXKOTZBBD-UHFFFAOYSA-N |
| TotalMolweight | 486.338 |
| Molweight | 486.338 |
| MonoisotopicMass | 485.011614 |
| CLogP | 4.1208 |
| CLogS | -9.722 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 331.09 |
| Relative PSA | 0.29684 |
| PolarSurfaceArea | 124.75 |
| Druglikeness | 3.752 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.40625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,5-dichlorophenyl)sulfonyl-1-[(Z)-furan-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxalin-2-amine | 2 - 3-(2,5-dichlorophenyl)sulfonyl-1-[(Z)-furan-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxalin-2-amine