| MolName | N-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-hydroxyacetamide |
| MolecularFormula | C16H17N3O5 |
| Smiles | OCC(N/N=C\c(cc1)ccc1OCC(NCc1ccco1)=O)=O |
| InChI | InChI=1S/C16H17N3O5/c20-10-15(21)19-18-8-12-3-5-13(6-4-12)24-11-16(22)17-9-14-2-1-7-23-14/h1-8,20H,9-11H2,(H,17,22)(H,19,21) |
| InChIK | PRALMNPBPIIYPY-UHFFFAOYSA-N |
| TotalMolweight | 331.327 |
| Molweight | 331.327 |
| MonoisotopicMass | 331.116822 |
| CLogP | 0.4516 |
| CLogS | -2.834 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 263.52 |
| Relative PSA | 0.37083 |
| PolarSurfaceArea | 113.16 |
| Druglikeness | 5.3765 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-hydroxyacetamide | 2 - N-[(Z)-[4-[2-(furan-2-ylmethylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-hydroxyacetamide