| MolName | (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2-phenylimidazo[1,2-a]pyridin-3-yl)methanimine |
| MolecularFormula | C24H22N5Cl |
| Smiles | Clc(cc1)ccc1N(CC1)CCN1/N=C\c1c(-c2ccccc2)nc2n1cccc2 |
| InChI | InChI=1S/C24H22ClN5/c25-20-9-11-21(12-10-20)28-14-16-29(17-15-28)26-18-22-24(19-6-2-1-3-7-19)27-23-8-4-5-13-30(22)23/h1-13,18H,14-17H2 |
| InChIK | PRZGKYKPSUWSKP-UHFFFAOYSA-N |
| TotalMolweight | 415.927 |
| Molweight | 415.927 |
| MonoisotopicMass | 415.156372 |
| CLogP | 4.4488 |
| CLogS | -6.997 |
| H Acceptors | 5 |
| TotalSurfaceArea | 319.11 |
| Relative PSA | 0.11761 |
| PolarSurfaceArea | 36.14 |
| Druglikeness | 6.875 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2-phenylimidazo[1,2-a]pyridin-3-yl)methanimine | 2 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2-phenylimidazo[1,2-a]pyridin-3-yl)methanimine