| MolName | N,N'-bis[(Z)-naphthalen-2-ylmethylideneamino]butanediamide |
| MolecularFormula | C26H22N4O2 |
| Smiles | O=C(CCC(N/N=C\c1cc2ccccc2cc1)=O)N/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C26H22N4O2/c31-25(29-27-17-19-9-11-21-5-1-3-7-23(21)15-19)13-14-26(32)30-28-18-20-10-12-22-6-2-4-8-24(22)16-20/h1-12,15-18H,13-14H2,(H,29,31)(H,30,32) |
| InChIK | PSFWZQKGOPNSHJ-UHFFFAOYSA-N |
| TotalMolweight | 422.487 |
| Molweight | 422.487 |
| MonoisotopicMass | 422.174276 |
| CLogP | 5.836 |
| CLogS | -7.87 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 337.68 |
| Relative PSA | 0.21328 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 3.0152 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 2 |
| Symmetricatoms | 16 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-naphthalen-2-ylmethylideneamino]butanediamide | 2 - N,N'-bis[(Z)-naphthalen-2-ylmethylideneamino]butanediamide