| MolName | 1,3-bis[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]urea |
| MolecularFormula | C23H16N6O7 |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\NC(N/N=C\c2ccc(-c(cc3)ccc3[N+]([O-])=O)o2)=O)o1)=O |
| InChI | InChI=1S/C23H16N6O7/c30-23(26-24-13-19-9-11-21(35-19)15-1-5-17(6-2-15)28(31)32)27-25-14-20-10-12-22(36-20)16-3-7-18(8-4-16)29(33)34/h1-14H,(H2,26,27,30) |
| InChIK | PSOSHJFUCBFQRG-UHFFFAOYSA-N |
| TotalMolweight | 488.415 |
| Molweight | 488.415 |
| MonoisotopicMass | 488.108049 |
| CLogP | 3.6246 |
| CLogS | -8.67 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 369.45 |
| Relative PSA | 0.4007 |
| PolarSurfaceArea | 183.77 |
| Druglikeness | 0.55539 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.69444 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 19 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1,3-bis[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]urea | 2 - 1,3-bis[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]urea