| MolName | N-phenyl-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide |
| MolecularFormula | C13H11N3O2S |
| Smiles | O=C(C(N/N=C\c1cccs1)=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H11N3O2S/c17-12(15-10-5-2-1-3-6-10)13(18)16-14-9-11-7-4-8-19-11/h1-9H,(H,15,17)(H,16,18) |
| InChIK | PSOTWTAXUOXKCT-UHFFFAOYSA-N |
| TotalMolweight | 273.315 |
| Molweight | 273.315 |
| MonoisotopicMass | 273.057197 |
| CLogP | 2.0105 |
| CLogS | -3.535 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 212.14 |
| Relative PSA | 0.38121 |
| PolarSurfaceArea | 98.8 |
| Druglikeness | 5.1793 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-phenyl-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide | 2 - N-phenyl-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide