| MolName | 3-morpholin-4-ylsulfonyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| MolecularFormula | C19H18N3O4F3S |
| Smiles | O=C(c1cccc(S(N2CCOCC2)(=O)=O)c1)N/N=C\c1c(C(F)(F)F)cccc1 |
| InChI | InChI=1S/C19H18F3N3O4S/c20-19(21,22)17-7-2-1-4-15(17)13-23-24-18(26)14-5-3-6-16(12-14)30(27,28)25-8-10-29-11-9-25/h1-7,12-13H,8-11H2,(H,24,26) |
| InChIK | PTFLEJPXDIEXNU-UHFFFAOYSA-N |
| TotalMolweight | 441.429 |
| Molweight | 441.429 |
| MonoisotopicMass | 441.097011 |
| CLogP | 3.0927 |
| CLogS | -3.705 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 306.87 |
| Relative PSA | 0.25464 |
| PolarSurfaceArea | 96.45 |
| Druglikeness | -9.4192 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-morpholin-4-ylsulfonyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide | 2 - 3-morpholin-4-ylsulfonyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide