| MolName | [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| MolecularFormula | C27H17N3O4Cl4 |
| Smiles | O=C(CNC(c(cc1)cc(Cl)c1Cl)=O)N/N=C\c(c1ccccc1cc1)c1OC(c(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C27H17Cl4N3O4/c28-17-7-8-19(22(30)12-17)27(37)38-24-10-6-15-3-1-2-4-18(15)20(24)13-33-34-25(35)14-32-26(36)16-5-9-21(29)23(31)11-16/h1-13H,14H2,(H,32,36)(H,34,35) |
| InChIK | PTJDABIJJCQODH-UHFFFAOYSA-N |
| TotalMolweight | 589.261 |
| Molweight | 589.261 |
| MonoisotopicMass | 586.997315 |
| CLogP | 7.3342 |
| CLogS | -9.508 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 413.75 |
| Relative PSA | 0.20193 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.1016 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate | 2 - [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate