| MolName | (3S,4R)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| MolecularFormula | C19H16N3O4Br |
| Smiles | O=C([C@@H]([C@@H](CN1)c2ccccc2)C1=O)N/N=C\c(cc1OCOc1c1)c1Br |
| InChI | InChI=1S/C19H16BrN3O4/c20-14-7-16-15(26-10-27-16)6-12(14)8-22-23-19(25)17-13(9-21-18(17)24)11-4-2-1-3-5-11/h1-8,13,17H,9-10H2,(H,21,24)(H,23,25)/t13-,17-/m0/s1 |
| InChIK | PTJPWELXLPMEHL-GUYCJALGSA-N |
| TotalMolweight | 430.257 |
| Molweight | 430.257 |
| MonoisotopicMass | 429.032418 |
| CLogP | 3.4672 |
| CLogS | -5.342 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 280.35 |
| Relative PSA | 0.28718 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 4.9908 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 2 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (3S,4R)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide | 2 - (3S,4R)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide