| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| MolecularFormula | C25H17N8O3Cl3 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc(cc2)Cl)c2OCc(c(Cl)ccc2)c2Cl)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C25H17Cl3N8O3/c26-16-9-10-20(38-13-17-18(27)7-4-8-19(17)28)15(11-16)12-30-32-25(37)21-22(14-5-2-1-3-6-14)36(35-31-21)24-23(29)33-39-34-24/h1-12H,13H2,(H2,29,33)(H,32,37) |
| InChIK | PTXHFURAQRNUPS-UHFFFAOYSA-N |
| TotalMolweight | 583.822 |
| Molweight | 583.822 |
| MonoisotopicMass | 582.048918 |
| CLogP | 6.6117 |
| CLogS | -6.755 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 418.74 |
| Relative PSA | 0.30124 |
| PolarSurfaceArea | 146.34 |
| Druglikeness | 1.7579 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46154 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide