| MolName | N-(3-chlorophenyl)-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]oxamide |
| MolecularFormula | C15H10N3O2Cl3 |
| Smiles | O=C(C(N/N=C\c(ccc(Cl)c1)c1Cl)=O)Nc1cc(Cl)ccc1 |
| InChI | InChI=1S/C15H10Cl3N3O2/c16-10-2-1-3-12(6-10)20-14(22)15(23)21-19-8-9-4-5-11(17)7-13(9)18/h1-8H,(H,20,22)(H,21,23) |
| InChIK | PUQNAWAZPIXDAN-UHFFFAOYSA-N |
| TotalMolweight | 370.622 |
| Molweight | 370.622 |
| MonoisotopicMass | 368.983858 |
| CLogP | 3.9619 |
| CLogS | -5.733 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 262.46 |
| Relative PSA | 0.23055 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 3.76 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(3-chlorophenyl)-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]oxamide | 2 - N-(3-chlorophenyl)-N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]oxamide