| MolName | N-[(Z)-(3-hydroxyphenyl)methylideneamino]-4-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]benzamide |
| MolecularFormula | C21H18N4O3 |
| Smiles | Oc1cccc(/C=N\NC(c(cc2)ccc2N/N=C\c2cc(O)ccc2)=O)c1 |
| InChI | InChI=1S/C21H18N4O3/c26-19-5-1-3-15(11-19)13-22-24-18-9-7-17(8-10-18)21(28)25-23-14-16-4-2-6-20(27)12-16/h1-14,24,26-27H,(H,25,28) |
| InChIK | PUYBSBWZMLCQSB-UHFFFAOYSA-N |
| TotalMolweight | 374.399 |
| Molweight | 374.399 |
| MonoisotopicMass | 374.137891 |
| CLogP | 5.6915 |
| CLogS | -4.662 |
| H Acceptors | 7 |
| H Donors | 4 |
| TotalSurfaceArea | 295.67 |
| Relative PSA | 0.28809 |
| PolarSurfaceArea | 106.31 |
| Druglikeness | 4.4204 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-4-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]benzamide | 2 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-4-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]benzamide