| MolName | N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| MolecularFormula | C25H23N5O4S3 |
| Smiles | O=C(c(cc1)ccc1NS(c1cccs1)(=O)=O)N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1 |
| InChI | InChI=1S/C25H23N5O4S3/c31-24(19-8-10-20(11-9-19)29-37(32,33)22-7-4-16-35-22)28-26-17-21-23(18-5-2-1-3-6-18)27-25(36-21)30-12-14-34-15-13-30/h1-11,16-17,29H,12-15H2,(H,28,31) |
| InChIK | PVALGLZGAHHWHT-UHFFFAOYSA-N |
| TotalMolweight | 553.687 |
| Molweight | 553.687 |
| MonoisotopicMass | 553.091215 |
| CLogP | 4.6165 |
| CLogS | -6.695 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 399.03 |
| Relative PSA | 0.35408 |
| PolarSurfaceArea | 177.85 |
| Druglikeness | 7.8102 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54054 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide | 2 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide