| MolName | 2-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C19H20N7OI |
| Smiles | Ic1ccc(/C=N\Nc2nc(N3CCCCC3)nc(Nc3ccccc3)n2)o1 |
| InChI | InChI=1S/C19H20IN7O/c20-16-10-9-15(28-16)13-21-26-18-23-17(22-14-7-3-1-4-8-14)24-19(25-18)27-11-5-2-6-12-27/h1,3-4,7-10,13H,2,5-6,11-12H2,(H2,22,23,24,25,26) |
| InChIK | PVEARBHGZSKAFC-UHFFFAOYSA-N |
| TotalMolweight | 489.316 |
| Molweight | 489.316 |
| MonoisotopicMass | 489.077406 |
| CLogP | 6.3491 |
| CLogS | -6.366 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 318.31 |
| Relative PSA | 0.26704 |
| PolarSurfaceArea | 91.47 |
| Druglikeness | 4.7897 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine