| MolName | N-(furan-2-ylmethyl)-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C21H19N3O4 |
| Smiles | O=C(C(N/N=C\c(cccc1)c1OCc1ccccc1)=O)NCc1ccco1 |
| InChI | InChI=1S/C21H19N3O4/c25-20(22-14-18-10-6-12-27-18)21(26)24-23-13-17-9-4-5-11-19(17)28-15-16-7-2-1-3-8-16/h1-13H,14-15H2,(H,22,25)(H,24,26) |
| InChIK | PVRCKQBPVPUQCC-UHFFFAOYSA-N |
| TotalMolweight | 377.399 |
| Molweight | 377.399 |
| MonoisotopicMass | 377.137557 |
| CLogP | 2.3901 |
| CLogS | -4.364 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 303.17 |
| Relative PSA | 0.27912 |
| PolarSurfaceArea | 92.93 |
| Druglikeness | 3.7216 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(furan-2-ylmethyl)-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide | 2 - N-(furan-2-ylmethyl)-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide