| MolName | 2-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H17N8O3Cl2F3 |
| Smiles | [O-][N+](c(cc(/C=N\Nc1nc(N2CCOCC2)nc(Nc2cc(C(F)(F)F)ccc2)n1)c(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C21H17Cl2F3N8O3/c22-15-10-16(23)17(34(35)36)8-12(15)11-27-32-19-29-18(30-20(31-19)33-4-6-37-7-5-33)28-14-3-1-2-13(9-14)21(24,25)26/h1-3,8-11H,4-7H2,(H2,28,29,30,31,32) |
| InChIK | PWDMVGJKHVRGIA-UHFFFAOYSA-N |
| TotalMolweight | 557.319 |
| Molweight | 557.319 |
| MonoisotopicMass | 556.075275 |
| CLogP | 6.0894 |
| CLogS | -7.726 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 382.55 |
| Relative PSA | 0.29097 |
| PolarSurfaceArea | 133.38 |
| Druglikeness | -8.8945 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine