| MolName | N-[(Z)-(3-nitrophenyl)methylideneamino]quinolin-8-amine |
| MolecularFormula | C16H12N4O2 |
| Smiles | [O-][N+](c1cc(/C=N\Nc2cccc3cccnc23)ccc1)=O |
| InChI | InChI=1S/C16H12N4O2/c21-20(22)14-7-1-4-12(10-14)11-18-19-15-8-2-5-13-6-3-9-17-16(13)15/h1-11,19H |
| InChIK | PWHUXNCRRBWJAF-UHFFFAOYSA-N |
| TotalMolweight | 292.297 |
| Molweight | 292.297 |
| MonoisotopicMass | 292.096026 |
| CLogP | 4.2353 |
| CLogS | -4.315 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 226.27 |
| Relative PSA | 0.28444 |
| PolarSurfaceArea | 83.1 |
| Druglikeness | -3.1321 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-nitrophenyl)methylideneamino]quinolin-8-amine | 2 - N-[(Z)-(3-nitrophenyl)methylideneamino]quinolin-8-amine