| MolName | N,N'-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]nonanediamide |
| MolecularFormula | C23H24N4O2Cl4 |
| Smiles | O=C(CCCCCCCC(N/N=C\c(ccc(Cl)c1)c1Cl)=O)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C23H24Cl4N4O2/c24-18-10-8-16(20(26)12-18)14-28-30-22(32)6-4-2-1-3-5-7-23(33)31-29-15-17-9-11-19(25)13-21(17)27/h8-15H,1-7H2,(H,30,32)(H,31,33) |
| InChIK | PWXYHYKOPIXFFR-UHFFFAOYSA-N |
| TotalMolweight | 530.282 |
| Molweight | 530.282 |
| MonoisotopicMass | 528.065334 |
| CLogP | 8.1432 |
| CLogS | -8.952 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 398.96 |
| Relative PSA | 0.18052 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.103 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75758 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 12 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 16 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]nonanediamide | 2 - N,N'-bis[(Z)-(2,4-dichlorophenyl)methylideneamino]nonanediamide