| MolName | (Z,E)-3-(2-nitrophenyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]prop-2-en-1-imine |
| MolecularFormula | C18H14N4O4 |
| Smiles | [O-][N+](c1c(/C=C/C=N\N=C/C=C/c(cccc2)c2[N+]([O-])=O)cccc1)=O |
| InChI | InChI=1S/C18H14N4O4/c23-21(24)17-11-3-1-7-15(17)9-5-13-19-20-14-6-10-16-8-2-4-12-18(16)22(25)26/h1-14H |
| InChIK | PXADKZMQRKBQMZ-UHFFFAOYSA-N |
| TotalMolweight | 350.333 |
| Molweight | 350.333 |
| MonoisotopicMass | 350.101506 |
| CLogP | 2.979 |
| CLogS | -5.636 |
| H Acceptors | 8 |
| TotalSurfaceArea | 282.88 |
| Relative PSA | 0.29645 |
| PolarSurfaceArea | 116.36 |
| Druglikeness | -3.7483 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 13 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z,E)-3-(2-nitrophenyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]prop-2-en-1-imine | 2 - (Z,E)-3-(2-nitrophenyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]prop-2-en-1-imine