| MolName | N-[(Z)-(2-diphenylphosphoryloxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C26H21N2O3P |
| Smiles | O=C(c1ccccc1)N/N=C\c(cccc1)c1OP(c1ccccc1)(c1ccccc1)=O |
| InChI | InChI=1S/C26H21N2O3P/c29-26(21-12-4-1-5-13-21)28-27-20-22-14-10-11-19-25(22)31-32(30,23-15-6-2-7-16-23)24-17-8-3-9-18-24/h1-20H,(H,28,29) |
| InChIK | PXFAAAHXRDHBHF-UHFFFAOYSA-N |
| TotalMolweight | 440.438 |
| Molweight | 440.438 |
| MonoisotopicMass | 440.12898 |
| CLogP | 6.1578 |
| CLogS | -7.231 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 340.28 |
| Relative PSA | 0.18523 |
| PolarSurfaceArea | 77.57 |
| Druglikeness | -16.448 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-diphenylphosphoryloxyphenyl)methylideneamino]benzamide | 2 - N-[(Z)-(2-diphenylphosphoryloxyphenyl)methylideneamino]benzamide