| MolName | 2,6-dimorpholin-4-yl-N-[(Z)-[1-(2-phenoxyethyl)indol-3-yl]methylideneamino]pyrimidin-4-amine |
| MolecularFormula | C29H33N7O3 |
| Smiles | C(COc1ccccc1)n1c(cccc2)c2c(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C29H33N7O3/c1-2-6-24(7-3-1)39-19-14-36-22-23(25-8-4-5-9-26(25)36)21-30-33-27-20-28(34-10-15-37-16-11-34)32-29(31-27)35-12-17-38-18-13-35/h1-9,20-22H,10-19H2,(H,31,32,33) |
| InChIK | PXMCWBMQERFEPA-UHFFFAOYSA-N |
| TotalMolweight | 527.627 |
| Molweight | 527.627 |
| MonoisotopicMass | 527.264488 |
| CLogP | 5.1349 |
| CLogS | -4.815 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 411.52 |
| Relative PSA | 0.21598 |
| PolarSurfaceArea | 89.27 |
| Druglikeness | 3.5457 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51282 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 13 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,6-dimorpholin-4-yl-N-[(Z)-[1-(2-phenoxyethyl)indol-3-yl]methylideneamino]pyrimidin-4-amine | 2 - 2,6-dimorpholin-4-yl-N-[(Z)-[1-(2-phenoxyethyl)indol-3-yl]methylideneamino]pyrimidin-4-amine