| MolName | N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-2-(2-phenoxyethoxy)benzamide |
| MolecularFormula | C24H20N2O5F4 |
| Smiles | O=C(c(cccc1)c1OCCOc1ccccc1)N/N=C\c(ccc(OC(F)F)c1)c1OC(F)F |
| InChI | InChI=1S/C24H20F4N2O5/c25-23(26)34-18-11-10-16(21(14-18)35-24(27)28)15-29-30-22(31)19-8-4-5-9-20(19)33-13-12-32-17-6-2-1-3-7-17/h1-11,14-15,23-24H,12-13H2,(H,30,31) |
| InChIK | PXZFDBBJRRVAJE-UHFFFAOYSA-N |
| TotalMolweight | 492.424 |
| Molweight | 492.424 |
| MonoisotopicMass | 492.130835 |
| CLogP | 4.8954 |
| CLogS | -6.233 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 364.67 |
| Relative PSA | 0.20844 |
| PolarSurfaceArea | 78.38 |
| Druglikeness | -5.643 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 12 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-2-(2-phenoxyethoxy)benzamide | 2 - N-[(Z)-[2,4-bis(difluoromethoxy)phenyl]methylideneamino]-2-(2-phenoxyethoxy)benzamide