| MolName | N-[(Z)-2-[2-(furan-2-carbonyl)hydrazinyl]prop-2-enylideneamino]furan-2-carboxamide |
| MolecularFormula | C13H12N4O4 |
| Smiles | C=C(/C=N\NC(c1ccco1)=O)NNC(c1ccco1)=O |
| InChI | InChI=1S/C13H12N4O4/c1-9(15-17-13(19)11-5-3-7-21-11)8-14-16-12(18)10-4-2-6-20-10/h2-8,15H,1H2,(H,16,18)(H,17,19) |
| InChIK | PYJNONMAWJMVPR-UHFFFAOYSA-N |
| TotalMolweight | 288.262 |
| Molweight | 288.262 |
| MonoisotopicMass | 288.085856 |
| CLogP | 0.3994 |
| CLogS | -3.658 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 229.79 |
| Relative PSA | 0.43601 |
| PolarSurfaceArea | 108.87 |
| Druglikeness | 1.7933 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2-[2-(furan-2-carbonyl)hydrazinyl]prop-2-enylideneamino]furan-2-carboxamide | 2 - N-[(Z)-2-[2-(furan-2-carbonyl)hydrazinyl]prop-2-enylideneamino]furan-2-carboxamide